C15H30N2OS — CID 107815236
2-carbamothioyl-3-methyl-N-(7-methyloctyl)butanamide (PubChem CID 107815236) has the molecular formula C15H30N2OS and a molecular weight of 286.49 g/mol. Its IUPAC name is 2-carbamothioyl-3-methyl-N-(7-methyloctyl)butanamide.
| Compound Name | 2-carbamothioyl-3-methyl-N-(7-methyloctyl)butanamide |
|---|---|
| PubChem CID | 107815236 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 2-carbamothioyl-3-methyl-N-(7-methyloctyl)butanamide |
| SMILES | CC(C)CCCCCCNC(=O)C(C(N)=S)C(C)C |
| InChI | InChI=1S/C15H30N2OS/c1-11(2)9-7-5-6-8-10-17-15(18)13(12(3)4)14(16)19/h11-13H,5-10H2,1-4H3,(H2,16,19)(H,17,18) |
| InChIKey | HFHLTVBSRDPODM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|