C16H34N2O — CID 65269830
3-amino-2,2,3-trimethyl-N-(7-methyloctyl)butanamide (PubChem CID 65269830) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is 3-amino-2,2,3-trimethyl-N-(7-methyloctyl)butanamide.
| Compound Name | 3-amino-2,2,3-trimethyl-N-(7-methyloctyl)butanamide |
|---|---|
| PubChem CID | 65269830 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 3-amino-2,2,3-trimethyl-N-(7-methyloctyl)butanamide |
| SMILES | CC(C)CCCCCCNC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C16H34N2O/c1-13(2)11-9-7-8-10-12-18-14(19)15(3,4)16(5,6)17/h13H,7-12,17H2,1-6H3,(H,18,19) |
| InChIKey | RIXFJQMRFRMLEM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|