C18H34F3NO — CID 170026598
3,3,3-trifluoro-2,2-dimethyl-N-(11-methyldodecyl)propanamide (PubChem CID 170026598) has the molecular formula C18H34F3NO and a molecular weight of 337.47 g/mol. Its IUPAC name is 3,3,3-trifluoro-2,2-dimethyl-N-(11-methyldodecyl)propanamide.
| Compound Name | 3,3,3-trifluoro-2,2-dimethyl-N-(11-methyldodecyl)propanamide |
|---|---|
| PubChem CID | 170026598 |
| Molecular Formula | C18H34F3NO |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 3,3,3-trifluoro-2,2-dimethyl-N-(11-methyldodecyl)propanamide |
| SMILES | CC(C)CCCCCCCCCCNC(=O)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C18H34F3NO/c1-15(2)13-11-9-7-5-6-8-10-12-14-22-16(23)17(3,4)18(19,20)21/h15H,5-14H2,1-4H3,(H,22,23) |
| InChIKey | YDPJWVGNBITIRH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|