C12H11F5N2OS — CID 115564576
2-carbamothioyl-3-methyl-N-(2,3,4,5,6-pentafluorophenyl)butanamide (PubChem CID 115564576) has the molecular formula C12H11F5N2OS and a molecular weight of 326.29 g/mol. Its IUPAC name is 2-carbamothioyl-3-methyl-N-(2,3,4,5,6-pentafluorophenyl)butanamide.
| Compound Name | 2-carbamothioyl-3-methyl-N-(2,3,4,5,6-pentafluorophenyl)butanamide |
|---|---|
| PubChem CID | 115564576 |
| Molecular Formula | C12H11F5N2OS |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-carbamothioyl-3-methyl-N-(2,3,4,5,6-pentafluorophenyl)butanamide |
| SMILES | CC(C)C(C(=O)Nc1c(F)c(F)c(F)c(F)c1F)C(N)=S |
| InChI | InChI=1S/C12H11F5N2OS/c1-3(2)4(11(18)21)12(20)19-10-8(16)6(14)5(13)7(15)9(10)17/h3-4H,1-2H3,(H2,18,21)(H,19,20) |
| InChIKey | XHGVLMCVATZCNO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|