C11H9F5N2OS — CID 115564579
2-carbamothioyl-N-(2,3,4,5,6-pentafluorophenyl)butanamide (PubChem CID 115564579) has the molecular formula C11H9F5N2OS and a molecular weight of 312.26 g/mol. Its IUPAC name is 2-carbamothioyl-N-(2,3,4,5,6-pentafluorophenyl)butanamide.
| Compound Name | 2-carbamothioyl-N-(2,3,4,5,6-pentafluorophenyl)butanamide |
|---|---|
| PubChem CID | 115564579 |
| Molecular Formula | C11H9F5N2OS |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-carbamothioyl-N-(2,3,4,5,6-pentafluorophenyl)butanamide |
| SMILES | CCC(C(=O)Nc1c(F)c(F)c(F)c(F)c1F)C(N)=S |
| InChI | InChI=1S/C11H9F5N2OS/c1-2-3(10(17)20)11(19)18-9-7(15)5(13)4(12)6(14)8(9)16/h3H,2H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | VGTZFQARBABZSO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|