C11H12BrFN2OS — CID 104779003
N-(3-bromo-4-fluorophenyl)-2-carbamothioylbutanamide (PubChem CID 104779003) has the molecular formula C11H12BrFN2OS and a molecular weight of 319.20 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-2-carbamothioylbutanamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-2-carbamothioylbutanamide |
|---|---|
| PubChem CID | 104779003 |
| Molecular Formula | C11H12BrFN2OS |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-2-carbamothioylbutanamide |
| SMILES | CCC(C(=O)Nc1ccc(F)c(Br)c1)C(N)=S |
| InChI | InChI=1S/C11H12BrFN2OS/c1-2-7(10(14)17)11(16)15-6-3-4-9(13)8(12)5-6/h3-5,7H,2H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | DQHVBKKDTDLIHP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|