C11H12BrFN2O — CID 104778206
2-amino-N-(3-bromo-4-fluorophenyl)pent-4-enamide (PubChem CID 104778206) has the molecular formula C11H12BrFN2O and a molecular weight of 287.13 g/mol. Its IUPAC name is 2-amino-N-(3-bromo-4-fluorophenyl)pent-4-enamide.
| Compound Name | 2-amino-N-(3-bromo-4-fluorophenyl)pent-4-enamide |
|---|---|
| PubChem CID | 104778206 |
| Molecular Formula | C11H12BrFN2O |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-amino-N-(3-bromo-4-fluorophenyl)pent-4-enamide |
| SMILES | C=CCC(N)C(=O)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H12BrFN2O/c1-2-3-10(14)11(16)15-7-4-5-9(13)8(12)6-7/h2,4-6,10H,1,3,14H2,(H,15,16) |
| InChIKey | KPSAGXVVWCBJJC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|