C12H13F5N2O — CID 115564259
2-(aminomethyl)-N-(2,3,4,5,6-pentafluorophenyl)pentanamide (PubChem CID 115564259) has the molecular formula C12H13F5N2O and a molecular weight of 296.24 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2,3,4,5,6-pentafluorophenyl)pentanamide.
| Compound Name | 2-(aminomethyl)-N-(2,3,4,5,6-pentafluorophenyl)pentanamide |
|---|---|
| PubChem CID | 115564259 |
| Molecular Formula | C12H13F5N2O |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-(aminomethyl)-N-(2,3,4,5,6-pentafluorophenyl)pentanamide |
| SMILES | CCCC(CN)C(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F5N2O/c1-2-3-5(4-18)12(20)19-11-9(16)7(14)6(13)8(15)10(11)17/h5H,2-4,18H2,1H3,(H,19,20) |
| InChIKey | ZLKYJGOLOMDOTB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|