C24H8F15N3O3 — CID 88545240
1-N,2-N,3-N-tris(2,3,4,5,6-pentafluorophenyl)propane-1,2,3-tricarboxamide (PubChem CID 88545240) has the molecular formula C24H8F15N3O3 and a molecular weight of 671.32 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris(2,3,4,5,6-pentafluorophenyl)propane-1,2,3-tricarboxamide.
| Compound Name | 1-N,2-N,3-N-tris(2,3,4,5,6-pentafluorophenyl)propane-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 88545240 |
| Molecular Formula | C24H8F15N3O3 |
| Molecular Weight | 671.32 g/mol |
| Exact Mass | 671.03 |
| IUPAC Name | 1-N,2-N,3-N-tris(2,3,4,5,6-pentafluorophenyl)propane-1,2,3-tricarboxamide |
| SMILES | O=C(CC(CC(=O)Nc1c(F)c(F)c(F)c(F)c1F)C(=O)Nc1c(F)c(F)c(F)c(F)c1F)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H8F15N3O3/c25-6-9(28)15(34)21(16(35)10(6)29)40-4(43)1-3(24(45)42-23-19(38)13(32)8(27)14(33)20(23)39)2-5(44)41-22-17(36)11(30)7(26)12(31)18(22)37/h3H,1-2H2,(H,40,43)(H,41,44)(H,42,45) |
| InChIKey | WSMFVXOHMZOYQX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.32 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|