C11H11F5N2O — CID 78907367
N-(2,3,4,5,6-pentafluorophenyl)-2-(propan-2-ylamino)acetamide (PubChem CID 78907367) has the molecular formula C11H11F5N2O and a molecular weight of 282.21 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-2-(propan-2-ylamino)acetamide.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-2-(propan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 78907367 |
| Molecular Formula | C11H11F5N2O |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-2-(propan-2-ylamino)acetamide |
| SMILES | CC(C)NCC(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H11F5N2O/c1-4(2)17-3-5(19)18-11-9(15)7(13)6(12)8(14)10(11)16/h4,17H,3H2,1-2H3,(H,18,19) |
| InChIKey | BHMPPGFRONZWIU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|