C10H8F5N3O2 — CID 115564486
2-amino-N-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl]acetamide (PubChem CID 115564486) has the molecular formula C10H8F5N3O2 and a molecular weight of 297.18 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl]acetamide.
| Compound Name | 2-amino-N-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 115564486 |
| Molecular Formula | C10H8F5N3O2 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-amino-N-[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H8F5N3O2/c11-5-6(12)8(14)10(9(15)7(5)13)18-4(20)2-17-3(19)1-16/h1-2,16H2,(H,17,19)(H,18,20) |
| InChIKey | CQWDCUYUUOODQA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|