About 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide
2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide (PubChem CID 130157493) has the molecular formula C6H9N5O2S
and a molecular weight of 215.24 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide |
| PubChem CID | 130157493 |
| Molecular Formula | C6H9N5O2S |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)Nc1nncs1 |
| InChI | InChI=1S/C6H9N5O2S/c7-1-4(12)8-2-5(13)10-6-11-9-3-14-6/h3H,1-2,7H2,(H,8,12)(H,10,11,13) |
| InChIKey | MHQCTFUHDYQLQA-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide?
The IUPAC name of 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide (CID 130157493) is 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide.
What is the SMILES notation for 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide?
The canonical SMILES for 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide is NCC(=O)NCC(=O)Nc1nncs1.
What is the InChIKey of 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide?
The InChIKey is MHQCTFUHDYQLQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5O2S/c7-1-4(12)8-2-5(13)10-6-11-9-3-14-6/h3H,1-2,7H2,(H,8,12)(H,10,11,13).
What are the key properties of 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide?
2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide has a molecular weight of 215.24 g/mol, XLogP of -1.45, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-oxo-2-(1,3,4-thiadiazol-2-ylamino)ethyl]acetamide is sourced from PubChem (CID 130157493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).