C8H14N4OS — CID 47123067
2-(diethylamino)-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 47123067) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(diethylamino)-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(diethylamino)-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 47123067 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-(diethylamino)-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCN(CC)CC(=O)Nc1nncs1 |
| InChI | InChI=1S/C8H14N4OS/c1-3-12(4-2)5-7(13)10-8-11-9-6-14-8/h6H,3-5H2,1-2H3,(H,10,11,13) |
| InChIKey | UUCGYQPCHKBWBM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |