C10H16N4O2S — CID 47336615
N'-butyl-N'-ethyl-N-(1,3,4-thiadiazol-2-yl)oxamide (PubChem CID 47336615) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is N'-butyl-N'-ethyl-N-(1,3,4-thiadiazol-2-yl)oxamide.
| Compound Name | N'-butyl-N'-ethyl-N-(1,3,4-thiadiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 47336615 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N'-butyl-N'-ethyl-N-(1,3,4-thiadiazol-2-yl)oxamide |
| SMILES | CCCCN(CC)C(=O)C(=O)Nc1nncs1 |
| InChI | InChI=1S/C10H16N4O2S/c1-3-5-6-14(4-2)9(16)8(15)12-10-13-11-7-17-10/h7H,3-6H2,1-2H3,(H,12,13,15) |
| InChIKey | FQGHFNSIISWGCE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|