C24H39BrN2O2 — CID 163361775
N-(4-bromophenyl)-N',N'-dioctyloxamide (PubChem CID 163361775) has the molecular formula C24H39BrN2O2 and a molecular weight of 467.49 g/mol. Its IUPAC name is N-(4-bromophenyl)-N',N'-dioctyloxamide.
| Compound Name | N-(4-bromophenyl)-N',N'-dioctyloxamide |
|---|---|
| PubChem CID | 163361775 |
| Molecular Formula | C24H39BrN2O2 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-(4-bromophenyl)-N',N'-dioctyloxamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H39BrN2O2/c1-3-5-7-9-11-13-19-27(20-14-12-10-8-6-4-2)24(29)23(28)26-22-17-15-21(25)16-18-22/h15-18H,3-14,19-20H2,1-2H3,(H,26,28) |
| InChIKey | FQDSFYQBOFOEAT-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|