About N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide
N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide (PubChem CID 108519413) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide.
Molecular Properties
| Compound Name | N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide |
| PubChem CID | 108519413 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide |
| SMILES | CCCCN(CCC)C(=O)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H21N3O2/c1-3-5-11-19(10-4-2)16(21)15(20)18-14-8-6-13(12-17)7-9-14/h6-9H,3-5,10-11H2,1-2H3,(H,18,20) |
| InChIKey | AQAHKCXHBFHNRX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide?
The IUPAC name of N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide (CID 108519413) is N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide.
What is the SMILES notation for N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide?
The canonical SMILES for N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide is CCCCN(CCC)C(=O)C(=O)Nc1ccc(C#N)cc1.
What is the InChIKey of N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide?
The InChIKey is AQAHKCXHBFHNRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-3-5-11-19(10-4-2)16(21)15(20)18-14-8-6-13(12-17)7-9-14/h6-9H,3-5,10-11H2,1-2H3,(H,18,20).
What are the key properties of N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide?
N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide has a molecular weight of 287.36 g/mol, XLogP of 2.54, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-N-(4-cyanophenyl)-N'-propyloxamide is sourced from PubChem (CID 108519413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).