About N'-butyl-N-(4-iodophenyl)-N'-propyloxamide
N'-butyl-N-(4-iodophenyl)-N'-propyloxamide (PubChem CID 108521621) has the molecular formula C15H21IN2O2
and a molecular weight of 388.25 g/mol. Its IUPAC name is N'-butyl-N-(4-iodophenyl)-N'-propyloxamide.
Molecular Properties
| Compound Name | N'-butyl-N-(4-iodophenyl)-N'-propyloxamide |
| PubChem CID | 108521621 |
| Molecular Formula | C15H21IN2O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N'-butyl-N-(4-iodophenyl)-N'-propyloxamide |
| SMILES | CCCCN(CCC)C(=O)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C15H21IN2O2/c1-3-5-11-18(10-4-2)15(20)14(19)17-13-8-6-12(16)7-9-13/h6-9H,3-5,10-11H2,1-2H3,(H,17,19) |
| InChIKey | FHSDRAVULJRJRM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-N-(4-iodophenyl)-N'-propyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-N-(4-iodophenyl)-N'-propyloxamide?
The IUPAC name of N'-butyl-N-(4-iodophenyl)-N'-propyloxamide (CID 108521621) is N'-butyl-N-(4-iodophenyl)-N'-propyloxamide.
What is the SMILES notation for N'-butyl-N-(4-iodophenyl)-N'-propyloxamide?
The canonical SMILES for N'-butyl-N-(4-iodophenyl)-N'-propyloxamide is CCCCN(CCC)C(=O)C(=O)Nc1ccc(I)cc1.
What is the InChIKey of N'-butyl-N-(4-iodophenyl)-N'-propyloxamide?
The InChIKey is FHSDRAVULJRJRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21IN2O2/c1-3-5-11-18(10-4-2)15(20)14(19)17-13-8-6-12(16)7-9-13/h6-9H,3-5,10-11H2,1-2H3,(H,17,19).
What are the key properties of N'-butyl-N-(4-iodophenyl)-N'-propyloxamide?
N'-butyl-N-(4-iodophenyl)-N'-propyloxamide has a molecular weight of 388.25 g/mol, XLogP of 3.27, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-N-(4-iodophenyl)-N'-propyloxamide is sourced from PubChem (CID 108521621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).