C15H21IN2O2 — CID 47335971
N-(4-iodo-2-methylphenyl)-N',N'-dipropyloxamide (PubChem CID 47335971) has the molecular formula C15H21IN2O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-N',N'-dipropyloxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 47335971 |
| Molecular Formula | C15H21IN2O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C15H21IN2O2/c1-4-8-18(9-5-2)15(20)14(19)17-13-7-6-12(16)10-11(13)3/h6-7,10H,4-5,8-9H2,1-3H3,(H,17,19) |
| InChIKey | MGSWJVVUPXFUFR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|