C16H24N2O2 — CID 108528705
N-(2,5-dimethylphenyl)-N',N'-dipropyloxamide (PubChem CID 108528705) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N',N'-dipropyloxamide.
| Compound Name | N-(2,5-dimethylphenyl)-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 108528705 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C16H24N2O2/c1-5-9-18(10-6-2)16(20)15(19)17-14-11-12(3)7-8-13(14)4/h7-8,11H,5-6,9-10H2,1-4H3,(H,17,19) |
| InChIKey | XYWQOOLRENRWPQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|