C17H26N2O2 — CID 108515302
N'-butyl-N-(2,3-dimethylphenyl)-N'-propyloxamide (PubChem CID 108515302) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N'-butyl-N-(2,3-dimethylphenyl)-N'-propyloxamide.
| Compound Name | N'-butyl-N-(2,3-dimethylphenyl)-N'-propyloxamide |
|---|---|
| PubChem CID | 108515302 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N'-butyl-N-(2,3-dimethylphenyl)-N'-propyloxamide |
| SMILES | CCCCN(CCC)C(=O)C(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C17H26N2O2/c1-5-7-12-19(11-6-2)17(21)16(20)18-15-10-8-9-13(3)14(15)4/h8-10H,5-7,11-12H2,1-4H3,(H,18,20) |
| InChIKey | UPZFHPSWGOEGQD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|