C15H22N2O3 — CID 108509587
N-(4-hydroxy-2-methylphenyl)-N',N'-dipropyloxamide (PubChem CID 108509587) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)-N',N'-dipropyloxamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 108509587 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1ccc(O)cc1C |
| InChI | InChI=1S/C15H22N2O3/c1-4-8-17(9-5-2)15(20)14(19)16-13-7-6-12(18)10-11(13)3/h6-7,10,18H,4-5,8-9H2,1-3H3,(H,16,19) |
| InChIKey | CQEXJCVHHKAXBJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|