C16H23ClN2O3 — CID 108528740
N-(4-chloro-2-methoxy-5-methylphenyl)-N',N'-dipropyloxamide (PubChem CID 108528740) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-N',N'-dipropyloxamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N',N'-dipropyloxamide |
|---|---|
| PubChem CID | 108528740 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N',N'-dipropyloxamide |
| SMILES | CCCN(CCC)C(=O)C(=O)Nc1cc(C)c(Cl)cc1OC |
| InChI | InChI=1S/C16H23ClN2O3/c1-5-7-19(8-6-2)16(21)15(20)18-13-9-11(3)12(17)10-14(13)22-4/h9-10H,5-8H2,1-4H3,(H,18,20) |
| InChIKey | XVGBCLKXBGESOL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|