C17H17ClN2O3 — CID 108521016
N-(4-chloro-2-methoxy-5-methylphenyl)-N'-methyl-N'-phenyloxamide (PubChem CID 108521016) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-N'-methyl-N'-phenyloxamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N'-methyl-N'-phenyloxamide |
|---|---|
| PubChem CID | 108521016 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-N'-methyl-N'-phenyloxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C17H17ClN2O3/c1-11-9-14(15(23-3)10-13(11)18)19-16(21)17(22)20(2)12-7-5-4-6-8-12/h4-10H,1-3H3,(H,19,21) |
| InChIKey | VDVORWOCWZVTPP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|