C17H28N2O — CID 4157557
1,1-dibutyl-3-(2,3-dimethylphenyl)urea (PubChem CID 4157557) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,1-dibutyl-3-(2,3-dimethylphenyl)urea.
| Compound Name | 1,1-dibutyl-3-(2,3-dimethylphenyl)urea |
|---|---|
| PubChem CID | 4157557 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1,1-dibutyl-3-(2,3-dimethylphenyl)urea |
| SMILES | CCCCN(CCCC)C(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C17H28N2O/c1-5-7-12-19(13-8-6-2)17(20)18-16-11-9-10-14(3)15(16)4/h9-11H,5-8,12-13H2,1-4H3,(H,18,20) |
| InChIKey | UDLKXNXWTYTJQQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |