C22H30N2O — CID 15137572
1-butyl-3-(2,4-dimethylphenyl)-1-(3-phenylpropyl)urea (PubChem CID 15137572) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-butyl-3-(2,4-dimethylphenyl)-1-(3-phenylpropyl)urea.
| Compound Name | 1-butyl-3-(2,4-dimethylphenyl)-1-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 15137572 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 1-butyl-3-(2,4-dimethylphenyl)-1-(3-phenylpropyl)urea |
| SMILES | CCCCN(CCCc1ccccc1)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C22H30N2O/c1-4-5-15-24(16-9-12-20-10-7-6-8-11-20)22(25)23-21-14-13-18(2)17-19(21)3/h6-8,10-11,13-14,17H,4-5,9,12,15-16H2,1-3H3,(H,23,25) |
| InChIKey | AXHIFAWLPSYWCY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |