C28H34N2O — CID 15137604
1-benzyl-1-[(4-butylphenyl)methyl]-3-(2,4,5-trimethylphenyl)urea (PubChem CID 15137604) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-benzyl-1-[(4-butylphenyl)methyl]-3-(2,4,5-trimethylphenyl)urea.
| Compound Name | 1-benzyl-1-[(4-butylphenyl)methyl]-3-(2,4,5-trimethylphenyl)urea |
|---|---|
| PubChem CID | 15137604 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 1-benzyl-1-[(4-butylphenyl)methyl]-3-(2,4,5-trimethylphenyl)urea |
| SMILES | CCCCc1ccc(CN(Cc2ccccc2)C(=O)Nc2cc(C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C28H34N2O/c1-5-6-10-24-13-15-26(16-14-24)20-30(19-25-11-8-7-9-12-25)28(31)29-27-18-22(3)21(2)17-23(27)4/h7-9,11-18H,5-6,10,19-20H2,1-4H3,(H,29,31) |
| InChIKey | JXJKOOUNIHTFDJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |