C20H26N2O — CID 3705190
1-(4-butylphenyl)-3-(2,4,5-trimethylphenyl)urea (PubChem CID 3705190) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-(2,4,5-trimethylphenyl)urea.
| Compound Name | 1-(4-butylphenyl)-3-(2,4,5-trimethylphenyl)urea |
|---|---|
| PubChem CID | 3705190 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-(4-butylphenyl)-3-(2,4,5-trimethylphenyl)urea |
| SMILES | CCCCc1ccc(NC(=O)Nc2cc(C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C20H26N2O/c1-5-6-7-17-8-10-18(11-9-17)21-20(23)22-19-13-15(3)14(2)12-16(19)4/h8-13H,5-7H2,1-4H3,(H2,21,22,23) |
| InChIKey | OXLNBOHKXOIGHC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |