C21H27N3O — CID 44536218
1-(4-butylphenyl)-3-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)urea (PubChem CID 44536218) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)urea.
| Compound Name | 1-(4-butylphenyl)-3-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)urea |
|---|---|
| PubChem CID | 44536218 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-(4-butylphenyl)-3-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)urea |
| SMILES | CCCCc1ccc(NC(=O)Nc2ccc3c(c2)CCNCC3)cc1 |
| InChI | InChI=1S/C21H27N3O/c1-2-3-4-16-5-8-19(9-6-16)23-21(25)24-20-10-7-17-11-13-22-14-12-18(17)15-20/h5-10,15,22H,2-4,11-14H2,1H3,(H2,23,24,25) |
| InChIKey | HUFPWCUHJLEONZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |