C14H21N3O — CID 63901957
1-butyl-3-(1,2,3,4-tetrahydroisoquinolin-7-yl)urea (PubChem CID 63901957) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-butyl-3-(1,2,3,4-tetrahydroisoquinolin-7-yl)urea.
| Compound Name | 1-butyl-3-(1,2,3,4-tetrahydroisoquinolin-7-yl)urea |
|---|---|
| PubChem CID | 63901957 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-butyl-3-(1,2,3,4-tetrahydroisoquinolin-7-yl)urea |
| SMILES | CCCCNC(=O)Nc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C14H21N3O/c1-2-3-7-16-14(18)17-13-5-4-11-6-8-15-10-12(11)9-13/h4-5,9,15H,2-3,6-8,10H2,1H3,(H2,16,17,18) |
| InChIKey | ARBZSSSABZJCAD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|