C13H19N3O — CID 66935877
1-propan-2-yl-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea (PubChem CID 66935877) has the molecular formula C13H19N3O and a molecular weight of 233.32 g/mol. Its IUPAC name is 1-propan-2-yl-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea.
| Compound Name | 1-propan-2-yl-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea |
|---|---|
| PubChem CID | 66935877 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-propan-2-yl-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea |
| SMILES | CC(C)NC(=O)Nc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C13H19N3O/c1-9(2)15-13(17)16-12-4-3-11-8-14-6-5-10(11)7-12/h3-4,7,9,14H,5-6,8H2,1-2H3,(H2,15,16,17) |
| InChIKey | OTSZTPGDZYCAEA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |