C16H16FN3O — CID 63901955
1-(4-fluorophenyl)-3-(1,2,3,4-tetrahydroisoquinolin-7-yl)urea (PubChem CID 63901955) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(1,2,3,4-tetrahydroisoquinolin-7-yl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(1,2,3,4-tetrahydroisoquinolin-7-yl)urea |
|---|---|
| PubChem CID | 63901955 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(1,2,3,4-tetrahydroisoquinolin-7-yl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C16H16FN3O/c17-13-2-5-14(6-3-13)19-16(21)20-15-4-1-11-7-8-18-10-12(11)9-15/h1-6,9,18H,7-8,10H2,(H2,19,20,21) |
| InChIKey | IXLCPRXEXYRQEU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |