C17H25N3O — CID 66936252
1-(cyclohexylmethyl)-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea (PubChem CID 66936252) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea.
| Compound Name | 1-(cyclohexylmethyl)-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea |
|---|---|
| PubChem CID | 66936252 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-(1,2,3,4-tetrahydroisoquinolin-6-yl)urea |
| SMILES | O=C(NCC1CCCCC1)Nc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C17H25N3O/c21-17(19-11-13-4-2-1-3-5-13)20-16-7-6-15-12-18-9-8-14(15)10-16/h6-7,10,13,18H,1-5,8-9,11-12H2,(H2,19,20,21) |
| InChIKey | HTGWTWJRTXZJCP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |