C14H18Cl2N2O — CID 5235617
1-(cyclohexylmethyl)-3-(3,4-dichlorophenyl)urea (PubChem CID 5235617) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(cyclohexylmethyl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 5235617 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(NCC1CCCCC1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O/c15-12-7-6-11(8-13(12)16)18-14(19)17-9-10-4-2-1-3-5-10/h6-8,10H,1-5,9H2,(H2,17,18,19) |
| InChIKey | DGSVHPRFTNCVNT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |