C19H21Cl2N3O2 — CID 3687659
1-(3,4-dichlorophenyl)-3-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 3687659) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 3687659 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | COc1ccc(N2CCC(CNC(=O)Nc3ccc(Cl)c(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-26-16-5-3-15(4-6-16)24-9-8-13(12-24)11-22-19(25)23-14-2-7-17(20)18(21)10-14/h2-7,10,13H,8-9,11-12H2,1H3,(H2,22,23,25) |
| InChIKey | QADBRVDSNAZHDM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|