C19H21Cl2N3O2 — CID 121141708
1-(3,4-dichlorophenyl)-3-[4-(3-methoxypiperidin-1-yl)phenyl]urea (PubChem CID 121141708) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-(3-methoxypiperidin-1-yl)phenyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-(3-methoxypiperidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 121141708 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-(3-methoxypiperidin-1-yl)phenyl]urea |
| SMILES | COC1CCCN(c2ccc(NC(=O)Nc3ccc(Cl)c(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-26-16-3-2-10-24(12-16)15-7-4-13(5-8-15)22-19(25)23-14-6-9-17(20)18(21)11-14/h4-9,11,16H,2-3,10,12H2,1H3,(H2,22,23,25) |
| InChIKey | IVNPHOFORABEOX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|