C18H23N3O4 — CID 71809763
2-(2,5-dioxopyrrolidin-1-yl)-N-[4-(3-methoxypiperidin-1-yl)phenyl]acetamide (PubChem CID 71809763) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N-[4-(3-methoxypiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[4-(3-methoxypiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 71809763 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[4-(3-methoxypiperidin-1-yl)phenyl]acetamide |
| SMILES | COC1CCCN(c2ccc(NC(=O)CN3C(=O)CCC3=O)cc2)C1 |
| InChI | InChI=1S/C18H23N3O4/c1-25-15-3-2-10-20(11-15)14-6-4-13(5-7-14)19-16(22)12-21-17(23)8-9-18(21)24/h4-7,15H,2-3,8-12H2,1H3,(H,19,22) |
| InChIKey | TXJJSPMSBHPBRH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|