C23H30N2O2 — CID 121141552
3-(3,4-dimethylphenyl)-N-[4-(3-methoxypiperidin-1-yl)phenyl]propanamide (PubChem CID 121141552) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-[4-(3-methoxypiperidin-1-yl)phenyl]propanamide.
| Compound Name | 3-(3,4-dimethylphenyl)-N-[4-(3-methoxypiperidin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 121141552 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-[4-(3-methoxypiperidin-1-yl)phenyl]propanamide |
| SMILES | COC1CCCN(c2ccc(NC(=O)CCc3ccc(C)c(C)c3)cc2)C1 |
| InChI | InChI=1S/C23H30N2O2/c1-17-6-7-19(15-18(17)2)8-13-23(26)24-20-9-11-21(12-10-20)25-14-4-5-22(16-25)27-3/h6-7,9-12,15,22H,4-5,8,13-14,16H2,1-3H3,(H,24,26) |
| InChIKey | GSNRYYLPZYSLGJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|