C28H32N2O3 — CID 121141530
N-[4-(3-methoxypiperidin-1-yl)phenyl]-3-(4-phenylmethoxyphenyl)propanamide (PubChem CID 121141530) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[4-(3-methoxypiperidin-1-yl)phenyl]-3-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | N-[4-(3-methoxypiperidin-1-yl)phenyl]-3-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 121141530 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-[4-(3-methoxypiperidin-1-yl)phenyl]-3-(4-phenylmethoxyphenyl)propanamide |
| SMILES | COC1CCCN(c2ccc(NC(=O)CCc3ccc(OCc4ccccc4)cc3)cc2)C1 |
| InChI | InChI=1S/C28H32N2O3/c1-32-27-8-5-19-30(20-27)25-14-12-24(13-15-25)29-28(31)18-11-22-9-16-26(17-10-22)33-21-23-6-3-2-4-7-23/h2-4,6-7,9-10,12-17,27H,5,8,11,18-21H2,1H3,(H,29,31) |
| InChIKey | GQDKBZIGWYPCFF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|