C20H22Cl2N2O3 — CID 121141679
2-(2,4-dichlorophenoxy)-N-[4-(3-methoxypiperidin-1-yl)phenyl]acetamide (PubChem CID 121141679) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[4-(3-methoxypiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[4-(3-methoxypiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 121141679 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[4-(3-methoxypiperidin-1-yl)phenyl]acetamide |
| SMILES | COC1CCCN(c2ccc(NC(=O)COc3ccc(Cl)cc3Cl)cc2)C1 |
| InChI | InChI=1S/C20H22Cl2N2O3/c1-26-17-3-2-10-24(12-17)16-7-5-15(6-8-16)23-20(25)13-27-19-9-4-14(21)11-18(19)22/h4-9,11,17H,2-3,10,12-13H2,1H3,(H,23,25) |
| InChIKey | SYXQDJWHTPKYIX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|