C21H27N3O2 — CID 4226014
1-(3,4-dimethylphenyl)-3-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 4226014) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 4226014 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[[1-(4-methoxyphenyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | COc1ccc(N2CCC(CNC(=O)Nc3ccc(C)c(C)c3)C2)cc1 |
| InChI | InChI=1S/C21H27N3O2/c1-15-4-5-18(12-16(15)2)23-21(25)22-13-17-10-11-24(14-17)19-6-8-20(26-3)9-7-19/h4-9,12,17H,10-11,13-14H2,1-3H3,(H2,22,23,25) |
| InChIKey | ZBDXYOGKBNIIDH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|