C18H21N3O3 — CID 42766024
2-[(3,4-dimethylphenyl)carbamoylamino]-N-(4-methoxyphenyl)acetamide (PubChem CID 42766024) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)carbamoylamino]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(3,4-dimethylphenyl)carbamoylamino]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42766024 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)carbamoylamino]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-4-5-15(10-13(12)2)21-18(23)19-11-17(22)20-14-6-8-16(24-3)9-7-14/h4-10H,11H2,1-3H3,(H,20,22)(H2,19,21,23) |
| InChIKey | IHYNUBLPYBMBBP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |