C10H12N2O4 — CID 67025275
[2-(4-methoxyanilino)-2-oxoethyl]carbamic acid (PubChem CID 67025275) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl]carbamic acid.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 67025275 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl]carbamic acid |
| SMILES | COc1ccc(NC(=O)CNC(=O)O)cc1 |
| InChI | InChI=1S/C10H12N2O4/c1-16-8-4-2-7(3-5-8)12-9(13)6-11-10(14)15/h2-5,11H,6H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | OAMIGWOCWVEZBT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |