C14H20N3O3+ — CID 7297720
cyclopropyl-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]azanium (PubChem CID 7297720) has the molecular formula C14H20N3O3+ and a molecular weight of 278.33 g/mol. Its IUPAC name is cyclopropyl-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]azanium.
| Compound Name | cyclopropyl-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7297720 |
| Molecular Formula | C14H20N3O3+ |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | cyclopropyl-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]azanium |
| SMILES | COc1ccc(NC(=O)CNC(=O)C[NH2+]C2CC2)cc1 |
| InChI | InChI=1S/C14H19N3O3/c1-20-12-6-4-11(5-7-12)17-14(19)9-16-13(18)8-15-10-2-3-10/h4-7,10,15H,2-3,8-9H2,1H3,(H,16,18)(H,17,19)/p+1 |
| InChIKey | DFFRQYILLRBXSN-UHFFFAOYSA-O |
| XLogP | -0.52 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |