C17H22ClN3O4 — CID 5087238
2-chloro-N-cyclopropyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]propanamide (PubChem CID 5087238) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]propanamide.
| Compound Name | 2-chloro-N-cyclopropyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 5087238 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]propanamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)CN(C(=O)C(C)Cl)C2CC2)cc1 |
| InChI | InChI=1S/C17H22ClN3O4/c1-11(18)17(24)21(13-5-6-13)10-16(23)19-9-15(22)20-12-3-7-14(25-2)8-4-12/h3-4,7-8,11,13H,5-6,9-10H2,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | CQKILGXCERZBAO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|