C17H24ClN3O4 — CID 7406072
(2S)-2-chloro-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylpropanamide (PubChem CID 7406072) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is (2S)-2-chloro-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylpropanamide.
| Compound Name | (2S)-2-chloro-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 7406072 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (2S)-2-chloro-N-[2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylpropanamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)CN(C(=O)[C@H](C)Cl)C(C)C)cc1 |
| InChI | InChI=1S/C17H24ClN3O4/c1-11(2)21(17(24)12(3)18)10-16(23)19-9-15(22)20-13-5-7-14(25-4)8-6-13/h5-8,11-12H,9-10H2,1-4H3,(H,19,23)(H,20,22)/t12-/m0/s1 |
| InChIKey | PRZPUHFNORSAKI-LBPRGKRZSA-N |
| XLogP | 1.61 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|