C17H24ClN3O3 — CID 3537468
2-chloro-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylpropanamide (PubChem CID 3537468) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-chloro-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylpropanamide.
| Compound Name | 2-chloro-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 3537468 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-chloro-N-[2-[[2-(4-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-N-propan-2-ylpropanamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)CN(C(=O)C(C)Cl)C(C)C)cc1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-11(2)21(17(24)13(4)18)10-16(23)19-9-15(22)20-14-7-5-12(3)6-8-14/h5-8,11,13H,9-10H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | UZUNGNGFYXDEHC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|