C13H17ClN2O2 — CID 40803222
(2R)-2-chloro-N-[3-(4-methylanilino)-3-oxopropyl]propanamide (PubChem CID 40803222) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is (2R)-2-chloro-N-[3-(4-methylanilino)-3-oxopropyl]propanamide.
| Compound Name | (2R)-2-chloro-N-[3-(4-methylanilino)-3-oxopropyl]propanamide |
|---|---|
| PubChem CID | 40803222 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (2R)-2-chloro-N-[3-(4-methylanilino)-3-oxopropyl]propanamide |
| SMILES | Cc1ccc(NC(=O)CCNC(=O)[C@@H](C)Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-9-3-5-11(6-4-9)16-12(17)7-8-15-13(18)10(2)14/h3-6,10H,7-8H2,1-2H3,(H,15,18)(H,16,17)/t10-/m1/s1 |
| InChIKey | GCWBHOQSJOBTCS-SNVBAGLBSA-N |
| XLogP | 2.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|