C11H13Cl2NO3S — CID 21205262
3-(dichloromethylsulfonyl)-N-(4-methylphenyl)propanamide (PubChem CID 21205262) has the molecular formula C11H13Cl2NO3S and a molecular weight of 310.20 g/mol. Its IUPAC name is 3-(dichloromethylsulfonyl)-N-(4-methylphenyl)propanamide.
| Compound Name | 3-(dichloromethylsulfonyl)-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 21205262 |
| Molecular Formula | C11H13Cl2NO3S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 3-(dichloromethylsulfonyl)-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCS(=O)(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H13Cl2NO3S/c1-8-2-4-9(5-3-8)14-10(15)6-7-18(16,17)11(12)13/h2-5,11H,6-7H2,1H3,(H,14,15) |
| InChIKey | FAEMGYBMHJROGE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|