C11H14NO4S2- — CID 3564180
1-methyl-4-(4-sulfonatosulfanylbutanoylamino)benzene (PubChem CID 3564180) has the molecular formula C11H14NO4S2- and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-methyl-4-(4-sulfonatosulfanylbutanoylamino)benzene.
| Compound Name | 1-methyl-4-(4-sulfonatosulfanylbutanoylamino)benzene |
|---|---|
| PubChem CID | 3564180 |
| Molecular Formula | C11H14NO4S2- |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-methyl-4-(4-sulfonatosulfanylbutanoylamino)benzene |
| SMILES | Cc1ccc(NC(=O)CCCSS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H15NO4S2/c1-9-4-6-10(7-5-9)12-11(13)3-2-8-17-18(14,15)16/h4-7H,2-3,8H2,1H3,(H,12,13)(H,14,15,16)/p-1 |
| InChIKey | DKGZPVIWQMPSPR-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|