C17H26NNaO4S2 — CID 134881744
sodium (11-sulfonatosulfanylundecanoylamino)benzene (PubChem CID 134881744) has the molecular formula C17H26NNaO4S2 and a molecular weight of 395.52 g/mol. Its IUPAC name is sodium (11-sulfonatosulfanylundecanoylamino)benzene.
| Compound Name | sodium (11-sulfonatosulfanylundecanoylamino)benzene |
|---|---|
| PubChem CID | 134881744 |
| Molecular Formula | C17H26NNaO4S2 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | sodium (11-sulfonatosulfanylundecanoylamino)benzene |
| SMILES | O=C(CCCCCCCCCCSS(=O)(=O)[O-])Nc1ccccc1.[Na+] |
| InChI | InChI=1S/C17H27NO4S2.Na/c19-17(18-16-12-8-7-9-13-16)14-10-5-3-1-2-4-6-11-15-23-24(20,21)22;/h7-9,12-13H,1-6,10-11,14-15H2,(H,18,19)(H,20,21,22);/q;+1/p-1 |
| InChIKey | HNGGUSKBNHOVCL-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|